C17H18BrNO5 — CID 4874615
9'-bromo-2,2-dimethylspiro[1,3-dioxane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-4,6-dione (PubChem CID 4874615) has the molecular formula C17H18BrNO5 and a molecular weight of 396.24 g/mol. Its IUPAC name is 9'-bromo-2,2-dimethylspiro[1,3-dioxane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-4,6-dione.
| Compound Name | 9'-bromo-2,2-dimethylspiro[1,3-dioxane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-4,6-dione |
|---|---|
| PubChem CID | 4874615 |
| Molecular Formula | C17H18BrNO5 |
| Molecular Weight | 396.24 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 9'-bromo-2,2-dimethylspiro[1,3-dioxane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-4,6-dione |
| SMILES | CC1(C)OC(=O)C2(Cc3ccc(Br)cc3N3CCOCC32)C(=O)O1 |
| InChI | InChI=1S/C17H18BrNO5/c1-16(2)23-14(20)17(15(21)24-16)8-10-3-4-11(18)7-12(10)19-5-6-22-9-13(17)19/h3-4,7,13H,5-6,8-9H2,1-2H3 |
| InChIKey | ITCXFEKPNBPJPF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|