C23H24ClN5O2S — CID 4874749
8-[2-(4-chlorophenyl)sulfanylethylamino]-1,3-dimethyl-7-[(4-methylphenyl)methyl]purine-2,6-dione (PubChem CID 4874749) has the molecular formula C23H24ClN5O2S and a molecular weight of 470.00 g/mol. Its IUPAC name is 8-[2-(4-chlorophenyl)sulfanylethylamino]-1,3-dimethyl-7-[(4-methylphenyl)methyl]purine-2,6-dione.
| Compound Name | 8-[2-(4-chlorophenyl)sulfanylethylamino]-1,3-dimethyl-7-[(4-methylphenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 4874749 |
| Molecular Formula | C23H24ClN5O2S |
| Molecular Weight | 470.00 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 8-[2-(4-chlorophenyl)sulfanylethylamino]-1,3-dimethyl-7-[(4-methylphenyl)methyl]purine-2,6-dione |
| SMILES | Cc1ccc(Cn2c(NCCSc3ccc(Cl)cc3)nc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C23H24ClN5O2S/c1-15-4-6-16(7-5-15)14-29-19-20(27(2)23(31)28(3)21(19)30)26-22(29)25-12-13-32-18-10-8-17(24)9-11-18/h4-11H,12-14H2,1-3H3,(H,25,26) |
| InChIKey | JAXPJAWXDNGVNE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.00 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|