C18H20N4S — CID 4875066
2,7-dimethyl-N-(pyridin-3-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 4875066) has the molecular formula C18H20N4S and a molecular weight of 324.45 g/mol. Its IUPAC name is 2,7-dimethyl-N-(pyridin-3-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2,7-dimethyl-N-(pyridin-3-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 4875066 |
| Molecular Formula | C18H20N4S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2,7-dimethyl-N-(pyridin-3-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc(NCc2cccnc2)c2c3c(sc2n1)CC(C)CC3 |
| InChI | InChI=1S/C18H20N4S/c1-11-5-6-14-15(8-11)23-18-16(14)17(21-12(2)22-18)20-10-13-4-3-7-19-9-13/h3-4,7,9,11H,5-6,8,10H2,1-2H3,(H,20,21,22) |
| InChIKey | HSTAJKAXKSYTCE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |