C18H19N3O3 — CID 4875401
N-(3-cyanophenyl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide (PubChem CID 4875401) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-(3-cyanophenyl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide.
| Compound Name | N-(3-cyanophenyl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 4875401 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-(3-cyanophenyl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide |
| SMILES | N#Cc1cccc(NC(=O)CCN2C(=O)C3CCCCC3C2=O)c1 |
| InChI | InChI=1S/C18H19N3O3/c19-11-12-4-3-5-13(10-12)20-16(22)8-9-21-17(23)14-6-1-2-7-15(14)18(21)24/h3-5,10,14-15H,1-2,6-9H2,(H,20,22) |
| InChIKey | CQOIPNYHXFJQOD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|