C21H23F3N4O3 — CID 4876283
2-[methyl-[2-(2-morpholin-4-ylanilino)-2-oxoethyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 4876283) has the molecular formula C21H23F3N4O3 and a molecular weight of 436.43 g/mol. Its IUPAC name is 2-[methyl-[2-(2-morpholin-4-ylanilino)-2-oxoethyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[methyl-[2-(2-morpholin-4-ylanilino)-2-oxoethyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 4876283 |
| Molecular Formula | C21H23F3N4O3 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-[methyl-[2-(2-morpholin-4-ylanilino)-2-oxoethyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccccc1N1CCOCC1)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H23F3N4O3/c1-27(13-19(30)26-16-7-6-14(22)20(23)21(16)24)12-18(29)25-15-4-2-3-5-17(15)28-8-10-31-11-9-28/h2-7H,8-13H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | DDROEZCVGLLEMG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|