C21H21ClN2O4 — CID 4876339
N-(1,3-benzodioxol-5-ylmethyl)-1-(4-chlorobenzoyl)piperidine-3-carboxamide (PubChem CID 4876339) has the molecular formula C21H21ClN2O4 and a molecular weight of 400.86 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-1-(4-chlorobenzoyl)piperidine-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-1-(4-chlorobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 4876339 |
| Molecular Formula | C21H21ClN2O4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-1-(4-chlorobenzoyl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)C1CCCN(C(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C21H21ClN2O4/c22-17-6-4-15(5-7-17)21(26)24-9-1-2-16(12-24)20(25)23-11-14-3-8-18-19(10-14)28-13-27-18/h3-8,10,16H,1-2,9,11-13H2,(H,23,25) |
| InChIKey | LGWHSGCXGVRRCU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |