About [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate
[2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 4876562) has the molecular formula C17H18BrNO6S
and a molecular weight of 444.30 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate.
Molecular Properties
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate |
| PubChem CID | 4876562 |
| Molecular Formula | C17H18BrNO6S |
| Molecular Weight | 444.30 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)N(C)C2CCS(=O)(=O)C2)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C17H18BrNO6S/c1-10-13-7-11(18)3-4-14(13)25-16(10)17(21)24-8-15(20)19(2)12-5-6-26(22,23)9-12/h3-4,7,12H,5-6,8-9H2,1-2H3 |
| InChIKey | AVFMWWGWEVFCQU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate?
The IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate (CID 4876562) is [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate.
What is the SMILES notation for [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate?
The canonical SMILES for [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate is Cc1c(C(=O)OCC(=O)N(C)C2CCS(=O)(=O)C2)oc2ccc(Br)cc12.
What is the InChIKey of [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate?
The InChIKey is AVFMWWGWEVFCQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18BrNO6S/c1-10-13-7-11(18)3-4-14(13)25-16(10)17(21)24-8-15(20)19(2)12-5-6-26(22,23)9-12/h3-4,7,12H,5-6,8-9H2,1-2H3.
What are the key properties of [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate?
[2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate has a molecular weight of 444.30 g/mol, XLogP of 2.31, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,1-dioxothiolan-3-yl)-methylamino]-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate is sourced from PubChem (CID 4876562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).