C11H14F3N3O3 — CID 4876726
2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 4876726) has the molecular formula C11H14F3N3O3 and a molecular weight of 293.25 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 4876726 |
| Molecular Formula | C11H14F3N3O3 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCC2)C1=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H14F3N3O3/c12-11(13,14)6-15-7(18)5-17-8(19)10(16-9(17)20)3-1-2-4-10/h1-6H2,(H,15,18)(H,16,20) |
| InChIKey | NUBRQIRKDNMSJC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|