C25H22N2O6 — CID 4876835
5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-3-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 4876835) has the molecular formula C25H22N2O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-3-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-3-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4876835 |
| Molecular Formula | C25H22N2O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-3-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2ccc3c(c2)OCCO3)NC(=O)N(Cc2cc(=O)oc3cc4c(cc23)CCC4)C1=O |
| InChI | InChI=1S/C25H22N2O6/c1-25(17-5-6-19-21(12-17)32-8-7-31-19)23(29)27(24(30)26-25)13-16-11-22(28)33-20-10-15-4-2-3-14(15)9-18(16)20/h5-6,9-12H,2-4,7-8,13H2,1H3,(H,26,30) |
| InChIKey | MJJIGBPQHPTTEJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|