About (2-anilino-1,3-thiazol-4-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate
(2-anilino-1,3-thiazol-4-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 4877004) has the molecular formula C18H18N2O2S
and a molecular weight of 326.42 g/mol. Its IUPAC name is (2-anilino-1,3-thiazol-4-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
Molecular Properties
| Compound Name | (2-anilino-1,3-thiazol-4-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| PubChem CID | 4877004 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (2-anilino-1,3-thiazol-4-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCc1csc(Nc2ccccc2)n1)C1CC2C=CC1C2 |
| InChI | InChI=1S/C18H18N2O2S/c21-17(16-9-12-6-7-13(16)8-12)22-10-15-11-23-18(20-15)19-14-4-2-1-3-5-14/h1-7,11-13,16H,8-10H2,(H,19,20) |
| InChIKey | ADEPFHNLAVSKNM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2-anilino-1,3-thiazol-4-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-anilino-1,3-thiazol-4-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The IUPAC name of (2-anilino-1,3-thiazol-4-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (CID 4877004) is (2-anilino-1,3-thiazol-4-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
What is the SMILES notation for (2-anilino-1,3-thiazol-4-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The canonical SMILES for (2-anilino-1,3-thiazol-4-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate is O=C(OCc1csc(Nc2ccccc2)n1)C1CC2C=CC1C2.
What is the InChIKey of (2-anilino-1,3-thiazol-4-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The InChIKey is ADEPFHNLAVSKNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O2S/c21-17(16-9-12-6-7-13(16)8-12)22-10-15-11-23-18(20-15)19-14-4-2-1-3-5-14/h1-7,11-13,16H,8-10H2,(H,19,20).
What are the key properties of (2-anilino-1,3-thiazol-4-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
(2-anilino-1,3-thiazol-4-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate has a molecular weight of 326.42 g/mol, XLogP of 4.14, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-anilino-1,3-thiazol-4-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate is sourced from PubChem (CID 4877004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).