C19H19FN2O4 — CID 4877159
[2-[1-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-acetamidobenzoate (PubChem CID 4877159) has the molecular formula C19H19FN2O4 and a molecular weight of 358.37 g/mol. Its IUPAC name is [2-[1-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-acetamidobenzoate.
| Compound Name | [2-[1-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-acetamidobenzoate |
|---|---|
| PubChem CID | 4877159 |
| Molecular Formula | C19H19FN2O4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [2-[1-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-acetamidobenzoate |
| SMILES | CC(=O)Nc1cccc(C(=O)OCC(=O)NC(C)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H19FN2O4/c1-12(14-6-8-16(20)9-7-14)21-18(24)11-26-19(25)15-4-3-5-17(10-15)22-13(2)23/h3-10,12H,11H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | QVMRWGZUDPBRKK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |