About (1-oxo-1-phenylpropan-2-yl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate
(1-oxo-1-phenylpropan-2-yl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 4877178) has the molecular formula C16H18N2O5
and a molecular weight of 318.33 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate.
Molecular Properties
| Compound Name | (1-oxo-1-phenylpropan-2-yl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| PubChem CID | 4877178 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CC(OC(=O)CN1C(=O)NC(C)(C)C1=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O5/c1-10(13(20)11-7-5-4-6-8-11)23-12(19)9-18-14(21)16(2,3)17-15(18)22/h4-8,10H,9H2,1-3H3,(H,17,22) |
| InChIKey | NUFUSNWXMUQUJN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze (1-oxo-1-phenylpropan-2-yl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-oxo-1-phenylpropan-2-yl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate?
The IUPAC name of (1-oxo-1-phenylpropan-2-yl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate (CID 4877178) is (1-oxo-1-phenylpropan-2-yl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate.
What is the SMILES notation for (1-oxo-1-phenylpropan-2-yl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate?
The canonical SMILES for (1-oxo-1-phenylpropan-2-yl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate is CC(OC(=O)CN1C(=O)NC(C)(C)C1=O)C(=O)c1ccccc1.
What is the InChIKey of (1-oxo-1-phenylpropan-2-yl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate?
The InChIKey is NUFUSNWXMUQUJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O5/c1-10(13(20)11-7-5-4-6-8-11)23-12(19)9-18-14(21)16(2,3)17-15(18)22/h4-8,10H,9H2,1-3H3,(H,17,22).
What are the key properties of (1-oxo-1-phenylpropan-2-yl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate?
(1-oxo-1-phenylpropan-2-yl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate has a molecular weight of 318.33 g/mol, XLogP of 1.13, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-oxo-1-phenylpropan-2-yl) 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate is sourced from PubChem (CID 4877178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).