C12H18F3N3O3 — CID 4877302
2-[4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 4877302) has the molecular formula C12H18F3N3O3 and a molecular weight of 309.29 g/mol. Its IUPAC name is 2-[4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 4877302 |
| Molecular Formula | C12H18F3N3O3 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 2-[4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CC(C)CC1(C)NC(=O)N(CC(=O)NCC(F)(F)F)C1=O |
| InChI | InChI=1S/C12H18F3N3O3/c1-7(2)4-11(3)9(20)18(10(21)17-11)5-8(19)16-6-12(13,14)15/h7H,4-6H2,1-3H3,(H,16,19)(H,17,21) |
| InChIKey | RJPBJVIUALRGJV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|