About N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-2-fluorobenzohydrazide
N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-2-fluorobenzohydrazide (PubChem CID 4877378) has the molecular formula C21H24FN3O4S
and a molecular weight of 433.51 g/mol. Its IUPAC name is N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-2-fluorobenzohydrazide.
Molecular Properties
| Compound Name | N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-2-fluorobenzohydrazide |
| PubChem CID | 4877378 |
| Molecular Formula | C21H24FN3O4S |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-2-fluorobenzohydrazide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(C(=O)NNC(=O)c3ccccc3F)cc2)C1 |
| InChI | InChI=1S/C21H24FN3O4S/c1-14-11-15(2)13-25(12-14)30(28,29)17-9-7-16(8-10-17)20(26)23-24-21(27)18-5-3-4-6-19(18)22/h3-10,14-15H,11-13H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | NGMCWSUEWWGMGM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-2-fluorobenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-2-fluorobenzohydrazide?
The IUPAC name of N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-2-fluorobenzohydrazide (CID 4877378) is N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-2-fluorobenzohydrazide.
What is the SMILES notation for N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-2-fluorobenzohydrazide?
The canonical SMILES for N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-2-fluorobenzohydrazide is CC1CC(C)CN(S(=O)(=O)c2ccc(C(=O)NNC(=O)c3ccccc3F)cc2)C1.
What is the InChIKey of N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-2-fluorobenzohydrazide?
The InChIKey is NGMCWSUEWWGMGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24FN3O4S/c1-14-11-15(2)13-25(12-14)30(28,29)17-9-7-16(8-10-17)20(26)23-24-21(27)18-5-3-4-6-19(18)22/h3-10,14-15H,11-13H2,1-2H3,(H,23,26)(H,24,27).
What are the key properties of N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-2-fluorobenzohydrazide?
N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-2-fluorobenzohydrazide has a molecular weight of 433.51 g/mol, XLogP of 2.57, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoyl]-2-fluorobenzohydrazide is sourced from PubChem (CID 4877378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).