C14H18N2OS — CID 4877567
N-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylpentanamide (PubChem CID 4877567) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylpentanamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylpentanamide |
|---|---|
| PubChem CID | 4877567 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2-phenylpentanamide |
| SMILES | CCCC(C(=O)NC1=NCCS1)c1ccccc1 |
| InChI | InChI=1S/C14H18N2OS/c1-2-6-12(11-7-4-3-5-8-11)13(17)16-14-15-9-10-18-14/h3-5,7-8,12H,2,6,9-10H2,1H3,(H,15,16,17) |
| InChIKey | LYOJZTBFUOPKBA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |