C16H21NO — CID 4877671
N-(1,2,3,4-tetrahydronaphthalen-1-yl)cyclopentanecarboxamide (PubChem CID 4877671) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydronaphthalen-1-yl)cyclopentanecarboxamide.
| Compound Name | N-(1,2,3,4-tetrahydronaphthalen-1-yl)cyclopentanecarboxamide |
|---|---|
| PubChem CID | 4877671 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | N-(1,2,3,4-tetrahydronaphthalen-1-yl)cyclopentanecarboxamide |
| SMILES | O=C(NC1CCCc2ccccc21)C1CCCC1 |
| InChI | InChI=1S/C16H21NO/c18-16(13-7-1-2-8-13)17-15-11-5-9-12-6-3-4-10-14(12)15/h3-4,6,10,13,15H,1-2,5,7-9,11H2,(H,17,18) |
| InChIKey | DGCVBXTWMCFMKR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |