About 1-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]propyl]piperidine-4-carboxamide
1-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]propyl]piperidine-4-carboxamide (PubChem CID 48779494) has the molecular formula C14H23N5O2S
and a molecular weight of 325.44 g/mol. Its IUPAC name is 1-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]propyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]propyl]piperidine-4-carboxamide |
| PubChem CID | 48779494 |
| Molecular Formula | C14H23N5O2S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 1-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]propyl]piperidine-4-carboxamide |
| SMILES | Cc1csc(NC(=O)NCCCN2CCC(C(N)=O)CC2)n1 |
| InChI | InChI=1S/C14H23N5O2S/c1-10-9-22-14(17-10)18-13(21)16-5-2-6-19-7-3-11(4-8-19)12(15)20/h9,11H,2-8H2,1H3,(H2,15,20)(H2,16,17,18,21) |
| InChIKey | FFFHXFXZCSUDRW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]propyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]propyl]piperidine-4-carboxamide?
The IUPAC name of 1-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]propyl]piperidine-4-carboxamide (CID 48779494) is 1-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]propyl]piperidine-4-carboxamide.
What is the SMILES notation for 1-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]propyl]piperidine-4-carboxamide?
The canonical SMILES for 1-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]propyl]piperidine-4-carboxamide is Cc1csc(NC(=O)NCCCN2CCC(C(N)=O)CC2)n1.
What is the InChIKey of 1-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]propyl]piperidine-4-carboxamide?
The InChIKey is FFFHXFXZCSUDRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N5O2S/c1-10-9-22-14(17-10)18-13(21)16-5-2-6-19-7-3-11(4-8-19)12(15)20/h9,11H,2-8H2,1H3,(H2,15,20)(H2,16,17,18,21).
What are the key properties of 1-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]propyl]piperidine-4-carboxamide?
1-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]propyl]piperidine-4-carboxamide has a molecular weight of 325.44 g/mol, XLogP of 1.16, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]propyl]piperidine-4-carboxamide is sourced from PubChem (CID 48779494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).