C15H18N4S — CID 4878328
3,7-dimethyl-6-(2,4,5-trimethylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 4878328) has the molecular formula C15H18N4S and a molecular weight of 286.40 g/mol. Its IUPAC name is 3,7-dimethyl-6-(2,4,5-trimethylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 3,7-dimethyl-6-(2,4,5-trimethylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 4878328 |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 3,7-dimethyl-6-(2,4,5-trimethylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | Cc1cc(C)c(C2=Nn3c(C)nnc3SC2C)cc1C |
| InChI | InChI=1S/C15H18N4S/c1-8-6-10(3)13(7-9(8)2)14-11(4)20-15-17-16-12(5)19(15)18-14/h6-7,11H,1-5H3 |
| InChIKey | NBWXEPWUECLHKT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |