C15H20N4OS2 — CID 4879084
4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,4,6-trimethylphenyl)butanamide (PubChem CID 4879084) has the molecular formula C15H20N4OS2 and a molecular weight of 336.49 g/mol. Its IUPAC name is 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,4,6-trimethylphenyl)butanamide.
| Compound Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,4,6-trimethylphenyl)butanamide |
|---|---|
| PubChem CID | 4879084 |
| Molecular Formula | C15H20N4OS2 |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,4,6-trimethylphenyl)butanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCCSc2nnc(N)s2)c(C)c1 |
| InChI | InChI=1S/C15H20N4OS2/c1-9-7-10(2)13(11(3)8-9)17-12(20)5-4-6-21-15-19-18-14(16)22-15/h7-8H,4-6H2,1-3H3,(H2,16,18)(H,17,20) |
| InChIKey | ATIKMUGSWMDTMI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|