About 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-2-ylethyl)propanamide
3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-2-ylethyl)propanamide (PubChem CID 4879890) has the molecular formula C24H34N2O2
and a molecular weight of 382.55 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-2-ylethyl)propanamide.
Molecular Properties
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-2-ylethyl)propanamide |
| PubChem CID | 4879890 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-2-ylethyl)propanamide |
| SMILES | CC(C)(C)c1cc(CCC(=O)NCCc2ccccn2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H34N2O2/c1-23(2,3)19-15-17(16-20(22(19)28)24(4,5)6)10-11-21(27)26-14-12-18-9-7-8-13-25-18/h7-9,13,15-16,28H,10-12,14H2,1-6H3,(H,26,27) |
| InChIKey | BVJIMNAARFZIAF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-2-ylethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-2-ylethyl)propanamide?
The IUPAC name of 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-2-ylethyl)propanamide (CID 4879890) is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-2-ylethyl)propanamide.
What is the SMILES notation for 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-2-ylethyl)propanamide?
The canonical SMILES for 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-2-ylethyl)propanamide is CC(C)(C)c1cc(CCC(=O)NCCc2ccccn2)cc(C(C)(C)C)c1O.
What is the InChIKey of 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-2-ylethyl)propanamide?
The InChIKey is BVJIMNAARFZIAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34N2O2/c1-23(2,3)19-15-17(16-20(22(19)28)24(4,5)6)10-11-21(27)26-14-12-18-9-7-8-13-25-18/h7-9,13,15-16,28H,10-12,14H2,1-6H3,(H,26,27).
What are the key properties of 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-2-ylethyl)propanamide?
3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-2-ylethyl)propanamide has a molecular weight of 382.55 g/mol, XLogP of 4.67, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-pyridin-2-ylethyl)propanamide is sourced from PubChem (CID 4879890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).