C15H13NO4S — CID 4879901
2-[(3-methoxyphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 4879901) has the molecular formula C15H13NO4S and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[(3-methoxyphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 4879901 |
| Molecular Formula | C15H13NO4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 2-[(3-methoxyphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | COc1cccc(CN2C(=O)c3ccccc3S2(=O)=O)c1 |
| InChI | InChI=1S/C15H13NO4S/c1-20-12-6-4-5-11(9-12)10-16-15(17)13-7-2-3-8-14(13)21(16,18)19/h2-9H,10H2,1H3 |
| InChIKey | PVASPEWEOUMDER-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |