C16H16ClN3O3S — CID 4879904
2-[(4-chlorophenyl)sulfonyl-prop-2-enylamino]-N-pyridin-3-ylacetamide (PubChem CID 4879904) has the molecular formula C16H16ClN3O3S and a molecular weight of 365.84 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-prop-2-enylamino]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-prop-2-enylamino]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 4879904 |
| Molecular Formula | C16H16ClN3O3S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-prop-2-enylamino]-N-pyridin-3-ylacetamide |
| SMILES | C=CCN(CC(=O)Nc1cccnc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H16ClN3O3S/c1-2-10-20(12-16(21)19-14-4-3-9-18-11-14)24(22,23)15-7-5-13(17)6-8-15/h2-9,11H,1,10,12H2,(H,19,21) |
| InChIKey | DPYPQEJDXYLDMT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|