C22H23NO2 — CID 4879946
N-(3,3-diphenylpropyl)-2,5-dimethylfuran-3-carboxamide (PubChem CID 4879946) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-(3,3-diphenylpropyl)-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 4879946 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N-(3,3-diphenylpropyl)-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCC(c2ccccc2)c2ccccc2)c(C)o1 |
| InChI | InChI=1S/C22H23NO2/c1-16-15-21(17(2)25-16)22(24)23-14-13-20(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,15,20H,13-14H2,1-2H3,(H,23,24) |
| InChIKey | MBQNDFJOGOCHND-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |