About [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-hydroxybenzoate
[1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-hydroxybenzoate (PubChem CID 4879957) has the molecular formula C19H16N2O4S
and a molecular weight of 368.41 g/mol. Its IUPAC name is [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-hydroxybenzoate.
Molecular Properties
| Compound Name | [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-hydroxybenzoate |
| PubChem CID | 4879957 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-hydroxybenzoate |
| SMILES | CC(OC(=O)c1ccc(O)cc1)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C19H16N2O4S/c1-12(25-18(24)14-7-9-15(22)10-8-14)17(23)21-19-20-16(11-26-19)13-5-3-2-4-6-13/h2-12,22H,1H3,(H,20,21,23) |
| InChIKey | AKYYEHVUNUTCLI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-hydroxybenzoate?
The IUPAC name of [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-hydroxybenzoate (CID 4879957) is [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-hydroxybenzoate.
What is the SMILES notation for [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-hydroxybenzoate?
The canonical SMILES for [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-hydroxybenzoate is CC(OC(=O)c1ccc(O)cc1)C(=O)Nc1nc(-c2ccccc2)cs1.
What is the InChIKey of [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-hydroxybenzoate?
The InChIKey is AKYYEHVUNUTCLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O4S/c1-12(25-18(24)14-7-9-15(22)10-8-14)17(23)21-19-20-16(11-26-19)13-5-3-2-4-6-13/h2-12,22H,1H3,(H,20,21,23).
What are the key properties of [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-hydroxybenzoate?
[1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-hydroxybenzoate has a molecular weight of 368.41 g/mol, XLogP of 3.70, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 4-hydroxybenzoate is sourced from PubChem (CID 4879957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).