About N-benzyl-2-(5-chloro-2,4-dimethoxyanilino)propanamide
N-benzyl-2-(5-chloro-2,4-dimethoxyanilino)propanamide (PubChem CID 4880305) has the molecular formula C18H21ClN2O3
and a molecular weight of 348.83 g/mol. Its IUPAC name is N-benzyl-2-(5-chloro-2,4-dimethoxyanilino)propanamide.
Molecular Properties
| Compound Name | N-benzyl-2-(5-chloro-2,4-dimethoxyanilino)propanamide |
| PubChem CID | 4880305 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-benzyl-2-(5-chloro-2,4-dimethoxyanilino)propanamide |
| SMILES | COc1cc(OC)c(NC(C)C(=O)NCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C18H21ClN2O3/c1-12(18(22)20-11-13-7-5-4-6-8-13)21-15-9-14(19)16(23-2)10-17(15)24-3/h4-10,12,21H,11H2,1-3H3,(H,20,22) |
| InChIKey | OERNLJZCJNBYGF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2-(5-chloro-2,4-dimethoxyanilino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-(5-chloro-2,4-dimethoxyanilino)propanamide?
The IUPAC name of N-benzyl-2-(5-chloro-2,4-dimethoxyanilino)propanamide (CID 4880305) is N-benzyl-2-(5-chloro-2,4-dimethoxyanilino)propanamide.
What is the SMILES notation for N-benzyl-2-(5-chloro-2,4-dimethoxyanilino)propanamide?
The canonical SMILES for N-benzyl-2-(5-chloro-2,4-dimethoxyanilino)propanamide is COc1cc(OC)c(NC(C)C(=O)NCc2ccccc2)cc1Cl.
What is the InChIKey of N-benzyl-2-(5-chloro-2,4-dimethoxyanilino)propanamide?
The InChIKey is OERNLJZCJNBYGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21ClN2O3/c1-12(18(22)20-11-13-7-5-4-6-8-13)21-15-9-14(19)16(23-2)10-17(15)24-3/h4-10,12,21H,11H2,1-3H3,(H,20,22).
What are the key properties of N-benzyl-2-(5-chloro-2,4-dimethoxyanilino)propanamide?
N-benzyl-2-(5-chloro-2,4-dimethoxyanilino)propanamide has a molecular weight of 348.83 g/mol, XLogP of 3.47, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-(5-chloro-2,4-dimethoxyanilino)propanamide is sourced from PubChem (CID 4880305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).