C20H22N2O3 — CID 4880364
2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-(2-methyl-2,3-dihydroindol-1-yl)propan-1-one (PubChem CID 4880364) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-(2-methyl-2,3-dihydroindol-1-yl)propan-1-one.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-(2-methyl-2,3-dihydroindol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 4880364 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-(2-methyl-2,3-dihydroindol-1-yl)propan-1-one |
| SMILES | CC(Nc1ccc2c(c1)OCCO2)C(=O)N1c2ccccc2CC1C |
| InChI | InChI=1S/C20H22N2O3/c1-13-11-15-5-3-4-6-17(15)22(13)20(23)14(2)21-16-7-8-18-19(12-16)25-10-9-24-18/h3-8,12-14,21H,9-11H2,1-2H3 |
| InChIKey | XLYITJSDNIMBHV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|