C15H13N3O3S — CID 4881194
2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 4881194) has the molecular formula C15H13N3O3S and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 4881194 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2CC=CCC2C(=O)N1Cc1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C15H13N3O3S/c19-14-9-4-1-2-5-10(9)15(20)18(14)8-12-16-17-13(21-12)11-6-3-7-22-11/h1-3,6-7,9-10H,4-5,8H2 |
| InChIKey | SLJHBTOQBOKCJR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|