C20H18N2O5 — CID 4881297
4,5-bis(furan-2-yl)-2-(3,4,5-trimethoxyphenyl)-1H-imidazole (PubChem CID 4881297) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is 4,5-bis(furan-2-yl)-2-(3,4,5-trimethoxyphenyl)-1H-imidazole.
| Compound Name | 4,5-bis(furan-2-yl)-2-(3,4,5-trimethoxyphenyl)-1H-imidazole |
|---|---|
| PubChem CID | 4881297 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4,5-bis(furan-2-yl)-2-(3,4,5-trimethoxyphenyl)-1H-imidazole |
| SMILES | COc1cc(-c2nc(-c3ccco3)c(-c3ccco3)[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C20H18N2O5/c1-23-15-10-12(11-16(24-2)19(15)25-3)20-21-17(13-6-4-8-26-13)18(22-20)14-7-5-9-27-14/h4-11H,1-3H3,(H,21,22) |
| InChIKey | MZXXLPCRJGZHAL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 82.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |