About 4-(2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide
4-(2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide (PubChem CID 4881718) has the molecular formula C16H14N4O2S2
and a molecular weight of 358.45 g/mol. Its IUPAC name is 4-(2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide.
Molecular Properties
| Compound Name | 4-(2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide |
| PubChem CID | 4881718 |
| Molecular Formula | C16H14N4O2S2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 4-(2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide |
| SMILES | CC(Sc1ncnc2sccc12)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C16H14N4O2S2/c1-9(24-16-12-6-7-23-15(12)18-8-19-16)14(22)20-11-4-2-10(3-5-11)13(17)21/h2-9H,1H3,(H2,17,21)(H,20,22) |
| InChIKey | UUKRBCAYAULAGO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide?
The IUPAC name of 4-(2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide (CID 4881718) is 4-(2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide.
What is the SMILES notation for 4-(2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide?
The canonical SMILES for 4-(2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide is CC(Sc1ncnc2sccc12)C(=O)Nc1ccc(C(N)=O)cc1.
What is the InChIKey of 4-(2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide?
The InChIKey is UUKRBCAYAULAGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O2S2/c1-9(24-16-12-6-7-23-15(12)18-8-19-16)14(22)20-11-4-2-10(3-5-11)13(17)21/h2-9H,1H3,(H2,17,21)(H,20,22).
What are the key properties of 4-(2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide?
4-(2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide has a molecular weight of 358.45 g/mol, XLogP of 2.91, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropanoylamino)benzamide is sourced from PubChem (CID 4881718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).