About 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide
2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide (PubChem CID 4882145) has the molecular formula C20H17N3O5S2
and a molecular weight of 443.51 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide.
Molecular Properties
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide |
| PubChem CID | 4882145 |
| Molecular Formula | C20H17N3O5S2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2o1)Nc1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C20H17N3O5S2/c24-19(13-29-20-23-17-5-1-2-6-18(17)28-20)22-14-7-9-16(10-8-14)30(25,26)21-12-15-4-3-11-27-15/h1-11,21H,12-13H2,(H,22,24) |
| InChIKey | VTFGIOABZNTPQW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide?
The IUPAC name of 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide (CID 4882145) is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide.
What is the SMILES notation for 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide?
The canonical SMILES for 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide is O=C(CSc1nc2ccccc2o1)Nc1ccc(S(=O)(=O)NCc2ccco2)cc1.
What is the InChIKey of 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide?
The InChIKey is VTFGIOABZNTPQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O5S2/c24-19(13-29-20-23-17-5-1-2-6-18(17)28-20)22-14-7-9-16(10-8-14)30(25,26)21-12-15-4-3-11-27-15/h1-11,21H,12-13H2,(H,22,24).
What are the key properties of 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide?
2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide has a molecular weight of 443.51 g/mol, XLogP of 3.63, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide is sourced from PubChem (CID 4882145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).