About N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-ethoxy-N-methylpyridine-3-carboxamide
N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-ethoxy-N-methylpyridine-3-carboxamide (PubChem CID 4882369) has the molecular formula C18H20N2O4
and a molecular weight of 328.37 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-ethoxy-N-methylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-ethoxy-N-methylpyridine-3-carboxamide |
| PubChem CID | 4882369 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-ethoxy-N-methylpyridine-3-carboxamide |
| SMILES | CCOc1ncccc1C(=O)N(C)CC1COc2ccccc2O1 |
| InChI | InChI=1S/C18H20N2O4/c1-3-22-17-14(7-6-10-19-17)18(21)20(2)11-13-12-23-15-8-4-5-9-16(15)24-13/h4-10,13H,3,11-12H2,1-2H3 |
| InChIKey | IFJALDLPXHYSKP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-ethoxy-N-methylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-ethoxy-N-methylpyridine-3-carboxamide?
The IUPAC name of N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-ethoxy-N-methylpyridine-3-carboxamide (CID 4882369) is N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-ethoxy-N-methylpyridine-3-carboxamide.
What is the SMILES notation for N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-ethoxy-N-methylpyridine-3-carboxamide?
The canonical SMILES for N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-ethoxy-N-methylpyridine-3-carboxamide is CCOc1ncccc1C(=O)N(C)CC1COc2ccccc2O1.
What is the InChIKey of N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-ethoxy-N-methylpyridine-3-carboxamide?
The InChIKey is IFJALDLPXHYSKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O4/c1-3-22-17-14(7-6-10-19-17)18(21)20(2)11-13-12-23-15-8-4-5-9-16(15)24-13/h4-10,13H,3,11-12H2,1-2H3.
What are the key properties of N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-ethoxy-N-methylpyridine-3-carboxamide?
N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-ethoxy-N-methylpyridine-3-carboxamide has a molecular weight of 328.37 g/mol, XLogP of 2.39, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-ethoxy-N-methylpyridine-3-carboxamide is sourced from PubChem (CID 4882369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).