C20H27NO3S — CID 4883034
N-(1-adamantyl)-N-ethyl-4-methylsulfonylbenzamide (PubChem CID 4883034) has the molecular formula C20H27NO3S and a molecular weight of 361.51 g/mol. Its IUPAC name is N-(1-adamantyl)-N-ethyl-4-methylsulfonylbenzamide.
| Compound Name | N-(1-adamantyl)-N-ethyl-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 4883034 |
| Molecular Formula | C20H27NO3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | N-(1-adamantyl)-N-ethyl-4-methylsulfonylbenzamide |
| SMILES | CCN(C(=O)c1ccc(S(C)(=O)=O)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H27NO3S/c1-3-21(19(22)17-4-6-18(7-5-17)25(2,23)24)20-11-14-8-15(12-20)10-16(9-14)13-20/h4-7,14-16H,3,8-13H2,1-2H3 |
| InChIKey | FGIQPZHNQLODRS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |