C36H72Cl2N4O2 — CID 48834
Ammonium, ethylenebis(iminocarbonylmethylene)bis(1-methyl-3-(2,2,6-trimethylcyclohexyl)propyl)bis(dimethyl-, dichloride (PubChem CID 48834) has the molecular formula C36H72Cl2N4O2 and a molecular weight of 663.90 g/mol. Its IUPAC name is [2-[2-[[2-[dimethyl-[4-(2,2,6-trimethylcyclohexyl)butan-2-yl]azaniumyl]acetyl]amino]ethylamino]-2-oxoethyl]-dimethyl-[4-(2,2,6-trimethylcyclohexyl)butan-2-yl]azanium dichloride.
| Compound Name | Ammonium, ethylenebis(iminocarbonylmethylene)bis(1-methyl-3-(2,2,6-trimethylcyclohexyl)propyl)bis(dimethyl-, dichloride |
|---|---|
| PubChem CID | 48834 |
| Molecular Formula | C36H72Cl2N4O2 |
| Molecular Weight | 663.90 g/mol |
| Exact Mass | 662.50 |
| IUPAC Name | [2-[2-[[2-[dimethyl-[4-(2,2,6-trimethylcyclohexyl)butan-2-yl]azaniumyl]acetyl]amino]ethylamino]-2-oxoethyl]-dimethyl-[4-(2,2,6-trimethylcyclohexyl)butan-2-yl]azanium dichloride |
| SMILES | CC1CCCC(C1CCC(C)[N+](C)(C)CC(=O)NCCNC(=O)C[N+](C)(C)C(C)CCC2C(CCCC2(C)C)C)(C)C.[Cl-].[Cl-] |
| InChIKey | IIPAQNHNCJWMTQ-UHFFFAOYSA-N |
| XLogP | N/A |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | 794 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|