C12H10ClN3O4 — CID 48838162
3-[(5-chloro-2-nitrophenoxy)methyl]-5-cyclopropyl-1,2,4-oxadiazole (PubChem CID 48838162) has the molecular formula C12H10ClN3O4 and a molecular weight of 295.68 g/mol. Its IUPAC name is 3-[(5-chloro-2-nitrophenoxy)methyl]-5-cyclopropyl-1,2,4-oxadiazole.
| Compound Name | 3-[(5-chloro-2-nitrophenoxy)methyl]-5-cyclopropyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 48838162 |
| Molecular Formula | C12H10ClN3O4 |
| Molecular Weight | 295.68 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 3-[(5-chloro-2-nitrophenoxy)methyl]-5-cyclopropyl-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(Cl)cc1OCc1noc(C2CC2)n1 |
| InChI | InChI=1S/C12H10ClN3O4/c13-8-3-4-9(16(17)18)10(5-8)19-6-11-14-12(20-15-11)7-1-2-7/h3-5,7H,1-2,6H2 |
| InChIKey | BWNKCTBFRJXEBY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 91.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.68 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|