About [2-(3,4-dimethylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate
[2-(3,4-dimethylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate (PubChem CID 4885103) has the molecular formula C14H15Cl2NO3
and a molecular weight of 316.18 g/mol. Its IUPAC name is [2-(3,4-dimethylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate |
| PubChem CID | 4885103 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)C2CC2(Cl)Cl)cc1C |
| InChI | InChI=1S/C14H15Cl2NO3/c1-8-3-4-10(5-9(8)2)17-12(18)7-20-13(19)11-6-14(11,15)16/h3-5,11H,6-7H2,1-2H3,(H,17,18) |
| InChIKey | HWTNHPCNJBSKER-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,4-dimethylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dimethylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate?
The IUPAC name of [2-(3,4-dimethylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate (CID 4885103) is [2-(3,4-dimethylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate.
What is the SMILES notation for [2-(3,4-dimethylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate?
The canonical SMILES for [2-(3,4-dimethylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate is Cc1ccc(NC(=O)COC(=O)C2CC2(Cl)Cl)cc1C.
What is the InChIKey of [2-(3,4-dimethylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate?
The InChIKey is HWTNHPCNJBSKER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2NO3/c1-8-3-4-10(5-9(8)2)17-12(18)7-20-13(19)11-6-14(11,15)16/h3-5,11H,6-7H2,1-2H3,(H,17,18).
What are the key properties of [2-(3,4-dimethylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate?
[2-(3,4-dimethylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate has a molecular weight of 316.18 g/mol, XLogP of 2.98, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dimethylanilino)-2-oxoethyl] 2,2-dichlorocyclopropane-1-carboxylate is sourced from PubChem (CID 4885103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).