About [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-phenylbenzoate
[2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-phenylbenzoate (PubChem CID 4885154) has the molecular formula C23H27NO5S
and a molecular weight of 429.54 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-phenylbenzoate.
Molecular Properties
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-phenylbenzoate |
| PubChem CID | 4885154 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-phenylbenzoate |
| SMILES | CC(C)CN(C(=O)COC(=O)c1ccc(-c2ccccc2)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H27NO5S/c1-17(2)14-24(21-12-13-30(27,28)16-21)22(25)15-29-23(26)20-10-8-19(9-11-20)18-6-4-3-5-7-18/h3-11,17,21H,12-16H2,1-2H3 |
| InChIKey | QBDJJVYKISWKRH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-phenylbenzoate?
The IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-phenylbenzoate (CID 4885154) is [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-phenylbenzoate.
What is the SMILES notation for [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-phenylbenzoate?
The canonical SMILES for [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-phenylbenzoate is CC(C)CN(C(=O)COC(=O)c1ccc(-c2ccccc2)cc1)C1CCS(=O)(=O)C1.
What is the InChIKey of [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-phenylbenzoate?
The InChIKey is QBDJJVYKISWKRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27NO5S/c1-17(2)14-24(21-12-13-30(27,28)16-21)22(25)15-29-23(26)20-10-8-19(9-11-20)18-6-4-3-5-7-18/h3-11,17,21H,12-16H2,1-2H3.
What are the key properties of [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-phenylbenzoate?
[2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-phenylbenzoate has a molecular weight of 429.54 g/mol, XLogP of 3.18, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-phenylbenzoate is sourced from PubChem (CID 4885154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).