C14H18N4O2 — CID 4885279
1-(2-methoxyphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)urea (PubChem CID 4885279) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)urea.
| Compound Name | 1-(2-methoxyphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)urea |
|---|---|
| PubChem CID | 4885279 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)urea |
| SMILES | COc1ccccc1NC(=O)Nc1c(C)nn(C)c1C |
| InChI | InChI=1S/C14H18N4O2/c1-9-13(10(2)18(3)17-9)16-14(19)15-11-7-5-6-8-12(11)20-4/h5-8H,1-4H3,(H2,15,16,19) |
| InChIKey | FWFVUYRHIHADRT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |