About N-(3-acetylphenyl)-2,4,5-trimethoxybenzamide
N-(3-acetylphenyl)-2,4,5-trimethoxybenzamide (PubChem CID 4885308) has the molecular formula C18H19NO5
and a molecular weight of 329.35 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2,4,5-trimethoxybenzamide.
Molecular Properties
| Compound Name | N-(3-acetylphenyl)-2,4,5-trimethoxybenzamide |
| PubChem CID | 4885308 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-(3-acetylphenyl)-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2cccc(C(C)=O)c2)cc1OC |
| InChI | InChI=1S/C18H19NO5/c1-11(20)12-6-5-7-13(8-12)19-18(21)14-9-16(23-3)17(24-4)10-15(14)22-2/h5-10H,1-4H3,(H,19,21) |
| InChIKey | MJEWSRUKIJEWIL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-acetylphenyl)-2,4,5-trimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-acetylphenyl)-2,4,5-trimethoxybenzamide?
The IUPAC name of N-(3-acetylphenyl)-2,4,5-trimethoxybenzamide (CID 4885308) is N-(3-acetylphenyl)-2,4,5-trimethoxybenzamide.
What is the SMILES notation for N-(3-acetylphenyl)-2,4,5-trimethoxybenzamide?
The canonical SMILES for N-(3-acetylphenyl)-2,4,5-trimethoxybenzamide is COc1cc(OC)c(C(=O)Nc2cccc(C(C)=O)c2)cc1OC.
What is the InChIKey of N-(3-acetylphenyl)-2,4,5-trimethoxybenzamide?
The InChIKey is MJEWSRUKIJEWIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO5/c1-11(20)12-6-5-7-13(8-12)19-18(21)14-9-16(23-3)17(24-4)10-15(14)22-2/h5-10H,1-4H3,(H,19,21).
What are the key properties of N-(3-acetylphenyl)-2,4,5-trimethoxybenzamide?
N-(3-acetylphenyl)-2,4,5-trimethoxybenzamide has a molecular weight of 329.35 g/mol, XLogP of 3.17, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-acetylphenyl)-2,4,5-trimethoxybenzamide is sourced from PubChem (CID 4885308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).