About 3-[3-(trifluoromethyl)piperidin-1-yl]-1,2-benzothiazole 1,1-dioxide
3-[3-(trifluoromethyl)piperidin-1-yl]-1,2-benzothiazole 1,1-dioxide (PubChem CID 4885395) has the molecular formula C13H13F3N2O2S
and a molecular weight of 318.32 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)piperidin-1-yl]-1,2-benzothiazole 1,1-dioxide.
Molecular Properties
| Compound Name | 3-[3-(trifluoromethyl)piperidin-1-yl]-1,2-benzothiazole 1,1-dioxide |
| PubChem CID | 4885395 |
| Molecular Formula | C13H13F3N2O2S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 3-[3-(trifluoromethyl)piperidin-1-yl]-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=S1(=O)N=C(N2CCCC(C(F)(F)F)C2)c2ccccc21 |
| InChI | InChI=1S/C13H13F3N2O2S/c14-13(15,16)9-4-3-7-18(8-9)12-10-5-1-2-6-11(10)21(19,20)17-12/h1-2,5-6,9H,3-4,7-8H2 |
| InChIKey | XTBSXJZHBLYALB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-(trifluoromethyl)piperidin-1-yl]-1,2-benzothiazole 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(trifluoromethyl)piperidin-1-yl]-1,2-benzothiazole 1,1-dioxide?
The IUPAC name of 3-[3-(trifluoromethyl)piperidin-1-yl]-1,2-benzothiazole 1,1-dioxide (CID 4885395) is 3-[3-(trifluoromethyl)piperidin-1-yl]-1,2-benzothiazole 1,1-dioxide.
What is the SMILES notation for 3-[3-(trifluoromethyl)piperidin-1-yl]-1,2-benzothiazole 1,1-dioxide?
The canonical SMILES for 3-[3-(trifluoromethyl)piperidin-1-yl]-1,2-benzothiazole 1,1-dioxide is O=S1(=O)N=C(N2CCCC(C(F)(F)F)C2)c2ccccc21.
What is the InChIKey of 3-[3-(trifluoromethyl)piperidin-1-yl]-1,2-benzothiazole 1,1-dioxide?
The InChIKey is XTBSXJZHBLYALB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3N2O2S/c14-13(15,16)9-4-3-7-18(8-9)12-10-5-1-2-6-11(10)21(19,20)17-12/h1-2,5-6,9H,3-4,7-8H2.
What are the key properties of 3-[3-(trifluoromethyl)piperidin-1-yl]-1,2-benzothiazole 1,1-dioxide?
3-[3-(trifluoromethyl)piperidin-1-yl]-1,2-benzothiazole 1,1-dioxide has a molecular weight of 318.32 g/mol, XLogP of 2.41, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(trifluoromethyl)piperidin-1-yl]-1,2-benzothiazole 1,1-dioxide is sourced from PubChem (CID 4885395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).