C23H21N3O3S — CID 4885981
ethyl 4-(9-cyano-6-oxo-8-phenyl-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazin-3-yl)benzoate (PubChem CID 4885981) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is ethyl 4-(9-cyano-6-oxo-8-phenyl-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazin-3-yl)benzoate.
| Compound Name | ethyl 4-(9-cyano-6-oxo-8-phenyl-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazin-3-yl)benzoate |
|---|---|
| PubChem CID | 4885981 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | ethyl 4-(9-cyano-6-oxo-8-phenyl-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazin-3-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2CSC3=C(C#N)C(c4ccccc4)CC(=O)N3C2)cc1 |
| InChI | InChI=1S/C23H21N3O3S/c1-2-29-23(28)17-8-10-18(11-9-17)25-14-26-21(27)12-19(16-6-4-3-5-7-16)20(13-24)22(26)30-15-25/h3-11,19H,2,12,14-15H2,1H3 |
| InChIKey | UPQLMILMUFCROP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |