C22H27FN2O — CID 48862621
3-(3-fluorophenyl)-2-methyl-N-[1-(1-phenylethyl)pyrrolidin-3-yl]propanamide (PubChem CID 48862621) has the molecular formula C22H27FN2O and a molecular weight of 354.47 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-2-methyl-N-[1-(1-phenylethyl)pyrrolidin-3-yl]propanamide.
| Compound Name | 3-(3-fluorophenyl)-2-methyl-N-[1-(1-phenylethyl)pyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 48862621 |
| Molecular Formula | C22H27FN2O |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 3-(3-fluorophenyl)-2-methyl-N-[1-(1-phenylethyl)pyrrolidin-3-yl]propanamide |
| SMILES | CC(Cc1cccc(F)c1)C(=O)NC1CCN(C(C)c2ccccc2)C1 |
| InChI | InChI=1S/C22H27FN2O/c1-16(13-18-7-6-10-20(23)14-18)22(26)24-21-11-12-25(15-21)17(2)19-8-4-3-5-9-19/h3-10,14,16-17,21H,11-13,15H2,1-2H3,(H,24,26) |
| InChIKey | FXWTUESRKAFWFT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |