C27H27ClN2O5 — CID 4886384
2'-(2-chlorophenyl)-3'-(2,2-dimethylpropanoyl)-2,2-dimethylspiro[1,3-dioxane-5,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine]-4,6-dione (PubChem CID 4886384) has the molecular formula C27H27ClN2O5 and a molecular weight of 494.98 g/mol. Its IUPAC name is 2'-(2-chlorophenyl)-3'-(2,2-dimethylpropanoyl)-2,2-dimethylspiro[1,3-dioxane-5,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine]-4,6-dione.
| Compound Name | 2'-(2-chlorophenyl)-3'-(2,2-dimethylpropanoyl)-2,2-dimethylspiro[1,3-dioxane-5,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine]-4,6-dione |
|---|---|
| PubChem CID | 4886384 |
| Molecular Formula | C27H27ClN2O5 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 2'-(2-chlorophenyl)-3'-(2,2-dimethylpropanoyl)-2,2-dimethylspiro[1,3-dioxane-5,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine]-4,6-dione |
| SMILES | CC1(C)OC(=O)C2(C(=O)O1)C(c1ccccc1Cl)C(C(=O)C(C)(C)C)N1N=Cc3ccccc3C12 |
| InChI | InChI=1S/C27H27ClN2O5/c1-25(2,3)22(31)20-19(17-12-8-9-13-18(17)28)27(23(32)34-26(4,5)35-24(27)33)21-16-11-7-6-10-15(16)14-29-30(20)21/h6-14,19-21H,1-5H3 |
| InChIKey | SAGVVZUJLGOLGD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|