C20H29N3O2 — CID 4888934
2-amino-4-decan-2-yl-7-methyl-5-oxo-4,6-dihydropyrano[3,2-c]pyridine-3-carbonitrile (PubChem CID 4888934) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-amino-4-decan-2-yl-7-methyl-5-oxo-4,6-dihydropyrano[3,2-c]pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-decan-2-yl-7-methyl-5-oxo-4,6-dihydropyrano[3,2-c]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 4888934 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 2-amino-4-decan-2-yl-7-methyl-5-oxo-4,6-dihydropyrano[3,2-c]pyridine-3-carbonitrile |
| SMILES | CCCCCCCCC(C)C1C(C#N)=C(N)Oc2cc(C)[nH]c(=O)c21 |
| InChI | InChI=1S/C20H29N3O2/c1-4-5-6-7-8-9-10-13(2)17-15(12-21)19(22)25-16-11-14(3)23-20(24)18(16)17/h11,13,17H,4-10,22H2,1-3H3,(H,23,24) |
| InChIKey | NLQDWUFFAQUSBW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|