C21H23N5O4 — CID 4889019
1,3-dimethylspiro[1,3-diazinane-5,9'-2,13,19-triazatetracyclo[9.8.0.02,8.013,18]nonadeca-1(11),14,16,18-tetraene]-2,4,6,12'-tetrone (PubChem CID 4889019) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is 1,3-dimethylspiro[1,3-diazinane-5,9'-2,13,19-triazatetracyclo[9.8.0.02,8.013,18]nonadeca-1(11),14,16,18-tetraene]-2,4,6,12'-tetrone.
| Compound Name | 1,3-dimethylspiro[1,3-diazinane-5,9'-2,13,19-triazatetracyclo[9.8.0.02,8.013,18]nonadeca-1(11),14,16,18-tetraene]-2,4,6,12'-tetrone |
|---|---|
| PubChem CID | 4889019 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 1,3-dimethylspiro[1,3-diazinane-5,9'-2,13,19-triazatetracyclo[9.8.0.02,8.013,18]nonadeca-1(11),14,16,18-tetraene]-2,4,6,12'-tetrone |
| SMILES | CN1C(=O)N(C)C(=O)C2(Cc3c(nc4ccccn4c3=O)N3CCCCCC32)C1=O |
| InChI | InChI=1S/C21H23N5O4/c1-23-18(28)21(19(29)24(2)20(23)30)12-13-16(25-10-6-3-4-8-14(21)25)22-15-9-5-7-11-26(15)17(13)27/h5,7,9,11,14H,3-4,6,8,10,12H2,1-2H3 |
| InChIKey | SJGZMEXDTAGOOK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 95.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|