C17H26N2O3 — CID 48894793
N-(2-ethyl-2-hydroxybutyl)-N'-(2-propan-2-ylphenyl)oxamide (PubChem CID 48894793) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-(2-ethyl-2-hydroxybutyl)-N'-(2-propan-2-ylphenyl)oxamide.
| Compound Name | N-(2-ethyl-2-hydroxybutyl)-N'-(2-propan-2-ylphenyl)oxamide |
|---|---|
| PubChem CID | 48894793 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-(2-ethyl-2-hydroxybutyl)-N'-(2-propan-2-ylphenyl)oxamide |
| SMILES | CCC(O)(CC)CNC(=O)C(=O)Nc1ccccc1C(C)C |
| InChI | InChI=1S/C17H26N2O3/c1-5-17(22,6-2)11-18-15(20)16(21)19-14-10-8-7-9-13(14)12(3)4/h7-10,12,22H,5-6,11H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | FYTOMCDFWBODHW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|