About 2-(2,3-dichlorophenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one
2-(2,3-dichlorophenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one (PubChem CID 4889668) has the molecular formula C20H16Cl2N2O4S
and a molecular weight of 451.33 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one.
Molecular Properties
| Compound Name | 2-(2,3-dichlorophenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one |
| PubChem CID | 4889668 |
| Molecular Formula | C20H16Cl2N2O4S |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one |
| SMILES | O=c1c2ccccc2c(/C=N/C2CCS(=O)(=O)C2)c(O)n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H16Cl2N2O4S/c21-16-6-3-7-17(18(16)22)24-19(25)14-5-2-1-4-13(14)15(20(24)26)10-23-12-8-9-29(27,28)11-12/h1-7,10,12,26H,8-9,11H2/b23-10+ |
| InChIKey | LUAWCEWEVOWODZ-AUEPDCJTSA-N |
| XLogP | 3.61 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dichlorophenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dichlorophenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one?
The IUPAC name of 2-(2,3-dichlorophenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one (CID 4889668) is 2-(2,3-dichlorophenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one.
What is the SMILES notation for 2-(2,3-dichlorophenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one?
The canonical SMILES for 2-(2,3-dichlorophenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one is O=c1c2ccccc2c(/C=N/C2CCS(=O)(=O)C2)c(O)n1-c1cccc(Cl)c1Cl.
What is the InChIKey of 2-(2,3-dichlorophenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one?
The InChIKey is LUAWCEWEVOWODZ-AUEPDCJTSA-N. The full InChI is InChI=1S/C20H16Cl2N2O4S/c21-16-6-3-7-17(18(16)22)24-19(25)14-5-2-1-4-13(14)15(20(24)26)10-23-12-8-9-29(27,28)11-12/h1-7,10,12,26H,8-9,11H2/b23-10+.
What are the key properties of 2-(2,3-dichlorophenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one?
2-(2,3-dichlorophenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one has a molecular weight of 451.33 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dichlorophenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one is sourced from PubChem (CID 4889668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).