C27H25N5OS2 — CID 4889736
3-benzylsulfanyl-6-[[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one (PubChem CID 4889736) has the molecular formula C27H25N5OS2 and a molecular weight of 499.67 g/mol. Its IUPAC name is 3-benzylsulfanyl-6-[[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one.
| Compound Name | 3-benzylsulfanyl-6-[[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4889736 |
| Molecular Formula | C27H25N5OS2 |
| Molecular Weight | 499.67 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 3-benzylsulfanyl-6-[[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2cc(C)n(-c3cccc(C)c3C)c2C)C(=O)N=C2SN=C(SCc3ccccc3)N21 |
| InChI | InChI=1S/C27H25N5OS2/c1-16-9-8-12-23(18(16)3)31-17(2)13-21(19(31)4)14-22-24(28)32-26(29-25(22)33)35-30-27(32)34-15-20-10-6-5-7-11-20/h5-14,28H,15H2,1-4H3/b22-14?,28-24+ |
| InChIKey | CJTLEWYOEWVWGY-MFZZGVMESA-N |
| XLogP | 6.22 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|