C15H21NO5S — CID 48910823
4-(3-acetylphenoxy)-N-propan-2-ylsulfonylbutanamide (PubChem CID 48910823) has the molecular formula C15H21NO5S and a molecular weight of 327.40 g/mol. Its IUPAC name is 4-(3-acetylphenoxy)-N-propan-2-ylsulfonylbutanamide.
| Compound Name | 4-(3-acetylphenoxy)-N-propan-2-ylsulfonylbutanamide |
|---|---|
| PubChem CID | 48910823 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 4-(3-acetylphenoxy)-N-propan-2-ylsulfonylbutanamide |
| SMILES | CC(=O)c1cccc(OCCCC(=O)NS(=O)(=O)C(C)C)c1 |
| InChI | InChI=1S/C15H21NO5S/c1-11(2)22(19,20)16-15(18)8-5-9-21-14-7-4-6-13(10-14)12(3)17/h4,6-7,10-11H,5,8-9H2,1-3H3,(H,16,18) |
| InChIKey | PUEDOHBBJNNHAJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|