C22H22N2O4S — CID 4891276
2-(3,4-dimethylphenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one (PubChem CID 4891276) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one.
| Compound Name | 2-(3,4-dimethylphenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one |
|---|---|
| PubChem CID | 4891276 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-4-[(1,1-dioxothiolan-3-yl)iminomethyl]-3-hydroxyisoquinolin-1-one |
| SMILES | Cc1ccc(-n2c(O)c(/C=N/C3CCS(=O)(=O)C3)c3ccccc3c2=O)cc1C |
| InChI | InChI=1S/C22H22N2O4S/c1-14-7-8-17(11-15(14)2)24-21(25)19-6-4-3-5-18(19)20(22(24)26)12-23-16-9-10-29(27,28)13-16/h3-8,11-12,16,26H,9-10,13H2,1-2H3/b23-12+ |
| InChIKey | BZUBDVQQKQGVOB-FSJBWODESA-N |
| XLogP | 2.92 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|