C22H19ClFN3O3S — CID 4892015
5-(3-chloro-4-fluorophenyl)-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 4892015) has the molecular formula C22H19ClFN3O3S and a molecular weight of 459.93 g/mol. Its IUPAC name is 5-(3-chloro-4-fluorophenyl)-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | 5-(3-chloro-4-fluorophenyl)-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 4892015 |
| Molecular Formula | C22H19ClFN3O3S |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 5-(3-chloro-4-fluorophenyl)-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | CSCCC1NC2(C(=O)Nc3ccccc32)C2C(=O)N(c3ccc(F)c(Cl)c3)C(=O)C12 |
| InChI | InChI=1S/C22H19ClFN3O3S/c1-31-9-8-16-17-18(22(26-16)12-4-2-3-5-15(12)25-21(22)30)20(29)27(19(17)28)11-6-7-14(24)13(23)10-11/h2-7,10,16-18,26H,8-9H2,1H3,(H,25,30) |
| InChIKey | YTMDHTPTSATCIP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|